
CAS 1040686-55-2
:N-[3-(2-Methoxyethoxy)phenyl]-3-propoxybenzenemethanamine
Description:
N-[3-(2-Methoxyethoxy)phenyl]-3-propoxybenzenemethanamine is a chemical compound characterized by its complex structure, which includes multiple aromatic rings and ether functionalities. This compound features a methoxyethoxy group, which enhances its solubility in organic solvents and may influence its biological activity. The presence of the propoxy group contributes to its hydrophobic characteristics, potentially affecting its interaction with biological membranes. The amine functional group suggests that this compound may exhibit basic properties, allowing it to participate in various chemical reactions, including protonation. Its molecular structure indicates potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. Additionally, the compound's unique arrangement of substituents may confer specific pharmacological properties, making it a candidate for further research in drug development. As with many organic compounds, its stability, reactivity, and biological activity would depend on environmental conditions and the presence of other chemical species.
Formula:C19H25NO3
InChI:InChI=1S/C19H25NO3/c1-3-10-22-18-8-4-6-16(13-18)15-20-17-7-5-9-19(14-17)23-12-11-21-2/h4-9,13-14,20H,3,10-12,15H2,1-2H3
InChI key:InChIKey=UNDYUMNJOGQAOV-UHFFFAOYSA-N
SMILES:N(CC1=CC(OCCC)=CC=C1)C2=CC(OCCOC)=CC=C2
Synonyms:- N-[3-(2-Methoxyethoxy)phenyl]-3-propoxybenzenemethanamine
- Benzenemethanamine, N-[3-(2-methoxyethoxy)phenyl]-3-propoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.