CymitQuimica logo

CAS 1040686-63-2

:

N-[2-(4-Chloro-2-methylphenoxy)ethyl]-4-(3-phenylpropoxy)benzenamine

Description:
N-[2-(4-Chloro-2-methylphenoxy)ethyl]-4-(3-phenylpropoxy)benzenamine, with the CAS number 1040686-63-2, is a synthetic organic compound characterized by its complex molecular structure, which includes multiple aromatic rings and functional groups. This compound features a chloro-substituted methylphenyl moiety and an ether linkage, contributing to its potential biological activity. The presence of the amine group suggests that it may participate in hydrogen bonding, influencing its solubility and reactivity. Typically, compounds of this nature are investigated for their pharmacological properties, including potential applications in medicinal chemistry. The specific arrangement of substituents can affect the compound's lipophilicity, which is crucial for its absorption and distribution in biological systems. Additionally, the presence of multiple aromatic systems may contribute to its stability and interaction with biological targets. Overall, this compound exemplifies the complexity often found in drug-like molecules, making it a subject of interest in chemical and pharmaceutical research.
Formula:C24H26ClNO2
InChI:InChI=1S/C24H26ClNO2/c1-19-18-21(25)9-14-24(19)28-17-15-26-22-10-12-23(13-11-22)27-16-5-8-20-6-3-2-4-7-20/h2-4,6-7,9-14,18,26H,5,8,15-17H2,1H3
InChI key:InChIKey=UMKJMXKKKGTDFY-UHFFFAOYSA-N
SMILES:O(CCNC1=CC=C(OCCCC2=CC=CC=C2)C=C1)C3=C(C)C=C(Cl)C=C3
Synonyms:
  • N-[2-(4-Chloro-2-methylphenoxy)ethyl]-4-(3-phenylpropoxy)benzenamine
  • Benzenamine, N-[2-(4-chloro-2-methylphenoxy)ethyl]-4-(3-phenylpropoxy)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.