
CAS 1040686-85-8
:2-Chloro-N-[3-(2-methoxyethoxy)phenyl]benzenepropanamine
Description:
2-Chloro-N-[3-(2-methoxyethoxy)phenyl]benzenepropanamine, with the CAS number 1040686-85-8, is a chemical compound characterized by its complex structure, which includes a chloro substituent and a propanamine moiety. This compound features a phenyl ring substituted with a 2-methoxyethoxy group, contributing to its potential solubility and reactivity. The presence of the chloro group may influence its electronic properties and reactivity, making it a candidate for various chemical reactions, including nucleophilic substitutions. The methoxyethoxy group enhances its hydrophilicity, which can affect its biological activity and interaction with other molecules. Such compounds are often studied for their potential applications in pharmaceuticals or as intermediates in organic synthesis. The specific characteristics, such as melting point, boiling point, and solubility, would depend on the compound's purity and the conditions under which it is studied. Overall, this compound's unique structure suggests potential utility in medicinal chemistry and material science.
Formula:C18H22ClNO2
InChI:InChI=1S/C18H22ClNO2/c1-21-12-13-22-17-9-4-8-16(14-17)20-11-5-7-15-6-2-3-10-18(15)19/h2-4,6,8-10,14,20H,5,7,11-13H2,1H3
InChI key:InChIKey=SDCXRLWDMVLSDN-UHFFFAOYSA-N
SMILES:N(CCCC1=C(Cl)C=CC=C1)C2=CC(OCCOC)=CC=C2
Synonyms:- 2-Chloro-N-[3-(2-methoxyethoxy)phenyl]benzenepropanamine
- Benzenepropanamine, 2-chloro-N-[3-(2-methoxyethoxy)phenyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.