CymitQuimica logo

CAS 1040687-66-8

:

N-[2-(2,5-Dimethylphenoxy)propyl]-4-phenoxybenzenamine

Description:
N-[2-(2,5-Dimethylphenoxy)propyl]-4-phenoxybenzenamine, identified by its CAS number 1040687-66-8, is a chemical compound characterized by its complex structure, which includes multiple aromatic rings and functional groups. This substance features a phenoxy group, which contributes to its potential as a ligand in various chemical reactions. The presence of the dimethylphenoxy moiety suggests that it may exhibit hydrophobic properties, influencing its solubility and interaction with biological systems. Additionally, the amine functional group indicates potential for hydrogen bonding, which can affect its reactivity and stability. The compound's molecular structure may allow for diverse applications in fields such as pharmaceuticals, agrochemicals, or materials science, where its unique properties can be harnessed. However, specific characteristics such as melting point, boiling point, and reactivity would require empirical data for precise evaluation. Overall, this compound's intricate design suggests it may play a significant role in various chemical processes or applications.
Formula:C23H25NO2
InChI:InChI=1S/C23H25NO2/c1-17-9-10-18(2)23(15-17)25-19(3)16-24-20-11-13-22(14-12-20)26-21-7-5-4-6-8-21/h4-15,19,24H,16H2,1-3H3
InChI key:InChIKey=CSDDKDZWBUHTNZ-UHFFFAOYSA-N
SMILES:O(C(CNC1=CC=C(OC2=CC=CC=C2)C=C1)C)C3=C(C)C=CC(C)=C3
Synonyms:
  • N-[2-(2,5-Dimethylphenoxy)propyl]-4-phenoxybenzenamine
  • Benzenamine, N-[2-(2,5-dimethylphenoxy)propyl]-4-phenoxy-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.