
CAS 1040688-53-6
:3-(3-Methylbutoxy)-N-[4-(phenylmethoxy)phenyl]benzenemethanamine
Description:
3-(3-Methylbutoxy)-N-[4-(phenylmethoxy)phenyl]benzenemethanamine, identified by its CAS number 1040688-53-6, is a chemical compound that belongs to the class of amines. This substance features a complex molecular structure characterized by a central benzenemethanamine core, which is substituted with various functional groups, including a 3-methylbutoxy group and a phenylmethoxy group. The presence of these substituents contributes to its potential hydrophobic properties, influencing its solubility and interaction with biological systems. The compound may exhibit specific pharmacological activities, making it of interest in medicinal chemistry and drug development. Its structural complexity suggests potential applications in various fields, including pharmaceuticals and materials science. However, detailed studies on its biological activity, toxicity, and environmental impact would be necessary to fully understand its characteristics and potential uses. As with any chemical substance, proper handling and safety measures should be observed, particularly in laboratory settings.
Formula:C25H29NO2
InChI:InChI=1S/C25H29NO2/c1-20(2)15-16-27-25-10-6-9-22(17-25)18-26-23-11-13-24(14-12-23)28-19-21-7-4-3-5-8-21/h3-14,17,20,26H,15-16,18-19H2,1-2H3
InChI key:InChIKey=BCYHEAPXGJAOIL-UHFFFAOYSA-N
SMILES:C(NC1=CC=C(OCC2=CC=CC=C2)C=C1)C3=CC(OCCC(C)C)=CC=C3
Synonyms:- 3-(3-Methylbutoxy)-N-[4-(phenylmethoxy)phenyl]benzenemethanamine
- Benzenemethanamine, 3-(3-methylbutoxy)-N-[4-(phenylmethoxy)phenyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.