
CAS 1040688-71-8
:2-Chloro-N-[2-(4-methylphenoxy)butyl]benzenamine
Description:
2-Chloro-N-[2-(4-methylphenoxy)butyl]benzenamine, identified by its CAS number 1040688-71-8, is a chemical compound that features a chloro substituent and an amine functional group, which suggests it may exhibit properties typical of both aromatic amines and chlorinated compounds. The presence of a 4-methylphenoxy group indicates that it has a phenolic structure, which can influence its solubility and reactivity. This compound is likely to be a solid at room temperature, with potential applications in pharmaceuticals or agrochemicals, given the structural motifs that are often associated with bioactivity. The chloro group may enhance its reactivity, making it a candidate for further chemical transformations. Additionally, the presence of the butyl chain suggests moderate hydrophobic characteristics, which could affect its interaction with biological systems. Safety data and handling precautions should be considered, as compounds with amine and chloro functionalities can pose health risks. Overall, this compound's unique structure may lead to interesting chemical behavior and potential applications in various fields.
Formula:C17H20ClNO
InChI:InChI=1S/C17H20ClNO/c1-3-14(20-15-10-8-13(2)9-11-15)12-19-17-7-5-4-6-16(17)18/h4-11,14,19H,3,12H2,1-2H3
InChI key:InChIKey=OWTKIRGMOFBEBZ-UHFFFAOYSA-N
SMILES:O(C(CNC1=C(Cl)C=CC=C1)CC)C2=CC=C(C)C=C2
Synonyms:- 2-Chloro-N-[2-(4-methylphenoxy)butyl]benzenamine
- Benzenamine, 2-chloro-N-[2-(4-methylphenoxy)butyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.