
CAS 1040688-96-7
:2-(3-Methylbutoxy)-N-(4-methylphenyl)benzenemethanamine
Description:
2-(3-Methylbutoxy)-N-(4-methylphenyl)benzenemethanamine, identified by its CAS number 1040688-96-7, is a chemical compound that belongs to the class of amines. This substance features a complex structure characterized by a benzene ring substituted with a methanamine group and an alkoxy side chain. The presence of the 3-methylbutoxy group contributes to its hydrophobic characteristics, potentially influencing its solubility and interaction with biological membranes. The N-(4-methylphenyl) moiety indicates that the compound has an aromatic amine structure, which may impart specific reactivity and stability properties. Such compounds often exhibit interesting pharmacological activities, making them of interest in medicinal chemistry. Additionally, the presence of multiple functional groups suggests that this compound could participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. However, detailed studies would be necessary to fully understand its physical properties, reactivity, and potential applications in various fields, including pharmaceuticals and materials science.
Formula:C19H25NO
InChI:InChI=1S/C19H25NO/c1-15(2)12-13-21-19-7-5-4-6-17(19)14-20-18-10-8-16(3)9-11-18/h4-11,15,20H,12-14H2,1-3H3
InChI key:InChIKey=ULMOHSXYJMETSW-UHFFFAOYSA-N
SMILES:C(NC1=CC=C(C)C=C1)C2=C(OCCC(C)C)C=CC=C2
Synonyms:- Benzenemethanamine, 2-(3-methylbutoxy)-N-(4-methylphenyl)-
- 2-(3-Methylbutoxy)-N-(4-methylphenyl)benzenemethanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.