CymitQuimica logo

CAS 1040689-67-5

:

N-(1,1-Dimethylethyl)-2-(2-methoxyphenoxy)-1-propanamine

Description:
N-(1,1-Dimethylethyl)-2-(2-methoxyphenoxy)-1-propanamine, identified by its CAS number 1040689-67-5, is an organic compound characterized by its amine functional group and a complex structure that includes a branched alkyl group and an ether moiety. This compound features a tert-butyl group (1,1-dimethylethyl) attached to a propanamine backbone, which contributes to its steric bulk and potential hydrophobic interactions. The presence of the methoxyphenoxy group enhances its solubility in organic solvents and may influence its biological activity. The compound's structure suggests potential applications in pharmaceuticals or agrochemicals, where such amine derivatives are often explored for their reactivity and ability to interact with biological systems. Additionally, the specific arrangement of functional groups may impart unique properties, such as altered lipophilicity or binding affinity, making it a subject of interest in medicinal chemistry and related fields. However, detailed studies would be necessary to fully elucidate its properties and potential applications.
Formula:C14H23NO2
InChI:InChI=1S/C14H23NO2/c1-11(10-15-14(2,3)4)17-13-9-7-6-8-12(13)16-5/h6-9,11,15H,10H2,1-5H3
InChI key:InChIKey=HHDLYSFZKOAIEK-UHFFFAOYSA-N
SMILES:O(C(CNC(C)(C)C)C)C1=C(OC)C=CC=C1
Synonyms:
  • 1-Propanamine, N-(1,1-dimethylethyl)-2-(2-methoxyphenoxy)-
  • N-(1,1-Dimethylethyl)-2-(2-methoxyphenoxy)-1-propanamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.