CAS 1040690-07-0

N-[2-(4-Methoxyphenoxy)ethyl]-2-(phenylmethoxy)benzenamine

Description:

N-[2-(4-Methoxyphenoxy)ethyl]-2-(phenylmethoxy)benzenamine is an organic compound characterized by its complex structure, which includes multiple aromatic rings and ether linkages. This compound features a primary amine functional group, which can participate in hydrogen bonding, influencing its solubility and reactivity. The presence of methoxy groups enhances its lipophilicity, potentially affecting its biological activity and interaction with various receptors or enzymes. The compound's molecular architecture suggests it may exhibit properties relevant to medicinal chemistry, particularly in the development of pharmaceuticals. Its specific interactions and potential applications would depend on its ability to bind to biological targets, which can be influenced by the steric and electronic effects of the substituents on the aromatic rings. Additionally, the compound's stability, reactivity, and solubility in different solvents would be critical factors in its practical applications. Overall, this compound represents a class of organic molecules that may have significant implications in drug design and development.

Formula: C₂₂H₂₃NO₃

InChI: InChI=1S/C22H23NO3/c1-24-19-11-13-20(14-12-19)25-16-15-23-21-9-5-6-10-22(21)26-17-18-7-3-2-4-8-18/h2-14,23H,15-17H2,1H3

InChI key: InChIKey=CHROKGPWNVQGRM-UHFFFAOYSA-N

SMILES: O(CC1=CC=CC=C1)C2=C(NCCOC3=CC=C(OC)C=C3)C=CC=C2

Synonyms:

• N-[2-(4-Methoxyphenoxy)ethyl]-2-(phenylmethoxy)benzenamine
• Benzenamine, N-[2-(4-methoxyphenoxy)ethyl]-2-(phenylmethoxy)-