
CAS 1040690-10-5
:N-[4-(Heptyloxy)phenyl]-2-(2-phenylethoxy)benzenemethanamine
Description:
N-[4-(Heptyloxy)phenyl]-2-(2-phenylethoxy)benzenemethanamine, identified by its CAS number 1040690-10-5, is an organic compound characterized by its complex molecular structure, which includes multiple aromatic rings and alkoxy groups. This compound features a heptyloxy substituent, which contributes to its hydrophobic properties, potentially influencing its solubility and interaction with biological membranes. The presence of phenyl and ethoxy groups suggests that it may exhibit interesting electronic properties and could participate in π-π stacking interactions, which are significant in various chemical and biological processes. Additionally, the amine functional group indicates potential for hydrogen bonding, which may affect its reactivity and interactions in different environments. Overall, the unique combination of hydrophobic and polar characteristics may render this compound suitable for applications in materials science, pharmaceuticals, or as a ligand in coordination chemistry. Further studies would be necessary to fully elucidate its properties and potential applications.
Formula:C28H35NO2
InChI:InChI=1S/C28H35NO2/c1-2-3-4-5-11-21-30-27-18-16-26(17-19-27)29-23-25-14-9-10-15-28(25)31-22-20-24-12-7-6-8-13-24/h6-10,12-19,29H,2-5,11,20-23H2,1H3
InChI key:InChIKey=ZQWJKBUILWVYPU-UHFFFAOYSA-N
SMILES:C(NC1=CC=C(OCCCCCCC)C=C1)C2=C(OCCC3=CC=CC=C3)C=CC=C2
Synonyms:- Benzenemethanamine, N-[4-(heptyloxy)phenyl]-2-(2-phenylethoxy)-
- N-[4-(Heptyloxy)phenyl]-2-(2-phenylethoxy)benzenemethanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.