
CAS 1040690-77-4
:N-[2-(2-Chlorophenoxy)propyl]-3-(3-phenylpropoxy)benzenamine
Description:
N-[2-(2-Chlorophenoxy)propyl]-3-(3-phenylpropoxy)benzenamine, identified by its CAS number 1040690-77-4, is a synthetic organic compound characterized by its complex molecular structure, which includes multiple aromatic rings and ether linkages. This compound features a chlorophenoxy group, which contributes to its potential biological activity, and a phenylpropoxy moiety that may enhance its lipophilicity and interaction with biological targets. The presence of the amine functional group suggests that it may participate in hydrogen bonding, influencing its solubility and reactivity. Typically, compounds of this nature are investigated for their pharmacological properties, potentially serving as intermediates in drug development or as active pharmaceutical ingredients. The specific characteristics, such as melting point, boiling point, and solubility, would depend on the compound's purity and the conditions under which it is studied. Overall, this compound's unique structure positions it as a candidate for further research in medicinal chemistry and related fields.
Formula:C24H26ClNO2
InChI:InChI=1S/C24H26ClNO2/c1-19(28-24-15-6-5-14-23(24)25)18-26-21-12-7-13-22(17-21)27-16-8-11-20-9-3-2-4-10-20/h2-7,9-10,12-15,17,19,26H,8,11,16,18H2,1H3
InChI key:InChIKey=FZDUGAMKCRJAFA-UHFFFAOYSA-N
SMILES:N(CC(OC1=C(Cl)C=CC=C1)C)C2=CC(OCCCC3=CC=CC=C3)=CC=C2
Synonyms:- Benzenamine, N-[2-(2-chlorophenoxy)propyl]-3-(3-phenylpropoxy)-
- N-[2-(2-Chlorophenoxy)propyl]-3-(3-phenylpropoxy)benzenamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.