
CAS 1040690-93-4
:3-(3-Methylbutoxy)-N-[3-(3-phenylpropoxy)phenyl]benzenemethanamine
Description:
3-(3-Methylbutoxy)-N-[3-(3-phenylpropoxy)phenyl]benzenemethanamine, identified by its CAS number 1040690-93-4, is a chemical compound that belongs to the class of amines. This substance features a complex structure characterized by multiple aromatic rings and ether linkages, which contribute to its potential biological activity. The presence of the 3-methylbutoxy group suggests that it may exhibit hydrophobic properties, influencing its solubility and interaction with biological membranes. The compound's design indicates potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific receptors or pathways. Its structural complexity may also suggest varied reactivity and the possibility of forming derivatives. However, detailed studies on its pharmacokinetics, toxicity, and specific biological effects would be necessary to fully understand its characteristics and potential uses. As with any chemical substance, safety data and handling precautions should be observed, especially in laboratory settings.
Formula:C27H33NO2
InChI:InChI=1S/C27H33NO2/c1-22(2)16-18-30-26-14-6-11-24(19-26)21-28-25-13-7-15-27(20-25)29-17-8-12-23-9-4-3-5-10-23/h3-7,9-11,13-15,19-20,22,28H,8,12,16-18,21H2,1-2H3
InChI key:InChIKey=ZHVFTEVXDQPUKH-UHFFFAOYSA-N
SMILES:C(NC1=CC(OCCCC2=CC=CC=C2)=CC=C1)C3=CC(OCCC(C)C)=CC=C3
Synonyms:- 3-(3-Methylbutoxy)-N-[3-(3-phenylpropoxy)phenyl]benzenemethanamine
- Benzenemethanamine, 3-(3-methylbutoxy)-N-[3-(3-phenylpropoxy)phenyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.