CymitQuimica logo

CAS 1040691-40-4

:

N-[2-(2-Ethoxyethoxy)phenyl]-3-(2-methylpropoxy)benzenemethanamine

Description:
N-[2-(2-Ethoxyethoxy)phenyl]-3-(2-methylpropoxy)benzenemethanamine, identified by its CAS number 1040691-40-4, is a chemical compound that belongs to the class of amines. This substance features a complex molecular structure characterized by multiple aromatic rings and ether functional groups, which contribute to its solubility and potential reactivity. The presence of ethoxy and propoxy groups suggests that it may exhibit moderate hydrophobic properties, influencing its interaction with biological systems and solvents. The amine functional group indicates potential for hydrogen bonding, which can affect its physical properties such as boiling point and melting point. Additionally, the compound may possess biological activity, making it of interest in pharmaceutical research. Its synthesis and characterization would typically involve standard organic chemistry techniques, and safety data should be consulted to understand its handling and potential hazards. Overall, this compound's unique structure may lead to diverse applications in medicinal chemistry and materials science.
Formula:C21H29NO3
InChI:InChI=1S/C21H29NO3/c1-4-23-12-13-24-21-11-6-5-10-20(21)22-15-18-8-7-9-19(14-18)25-16-17(2)3/h5-11,14,17,22H,4,12-13,15-16H2,1-3H3
InChI key:InChIKey=UDEJAYVNIUUVRQ-UHFFFAOYSA-N
SMILES:N(CC1=CC(OCC(C)C)=CC=C1)C2=C(OCCOCC)C=CC=C2
Synonyms:
  • N-[2-(2-Ethoxyethoxy)phenyl]-3-(2-methylpropoxy)benzenemethanamine
  • Benzenemethanamine, N-[2-(2-ethoxyethoxy)phenyl]-3-(2-methylpropoxy)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.