CymitQuimica logo

CAS 1040692-34-9

:

N-[2-[5-Methyl-2-(1-methylethyl)phenoxy]ethyl]-2-butanamine

Description:
N-[2-[5-Methyl-2-(1-methylethyl)phenoxy]ethyl]-2-butanamine, identified by its CAS number 1040692-34-9, is a chemical compound that belongs to the class of amines. This substance features a complex structure characterized by a butylamine moiety linked to a phenoxy group, which is further substituted with a branched alkyl chain. The presence of the methyl and isopropyl groups in its structure contributes to its hydrophobic characteristics, potentially influencing its solubility and interaction with biological systems. The compound may exhibit specific pharmacological properties, making it of interest in medicinal chemistry. Its synthesis and characterization would typically involve standard organic chemistry techniques, including purification methods such as chromatography. As with many amines, it may participate in various chemical reactions, including alkylation and acylation, and could serve as a precursor or intermediate in the synthesis of more complex molecules. Safety and handling precautions should be observed due to the potential reactivity and toxicity associated with amines.
Formula:C16H27NO
InChI:InChI=1S/C16H27NO/c1-6-14(5)17-9-10-18-16-11-13(4)7-8-15(16)12(2)3/h7-8,11-12,14,17H,6,9-10H2,1-5H3
InChI key:InChIKey=DGKPURJLTQZGON-UHFFFAOYSA-N
SMILES:O(CCNC(CC)C)C1=C(C(C)C)C=CC(C)=C1
Synonyms:
  • 2-Butanamine, N-[2-[5-methyl-2-(1-methylethyl)phenoxy]ethyl]-
  • N-[2-[5-Methyl-2-(1-methylethyl)phenoxy]ethyl]-2-butanamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.