CymitQuimica logo

CAS 1040693-36-4

:

N-[4-(2-Cyclohexylethoxy)phenyl]-4-methoxybenzeneethanamine

Description:
N-[4-(2-Cyclohexylethoxy)phenyl]-4-methoxybenzeneethanamine, identified by its CAS number 1040693-36-4, is a chemical compound that belongs to the class of organic amines. This substance features a complex molecular structure characterized by the presence of an ethoxy group, a methoxy group, and a cyclohexyl moiety, which contribute to its unique physical and chemical properties. Typically, compounds of this nature exhibit moderate to high lipophilicity due to the presence of hydrophobic groups, which can influence their solubility in organic solvents and biological membranes. The amine functional group suggests potential basicity, allowing for interactions with acids and other electrophiles. Additionally, the compound may exhibit interesting pharmacological properties, making it a candidate for research in medicinal chemistry. Its structural features may also allow for various substitution reactions, which can be explored for the synthesis of derivatives with altered biological activity. Overall, this compound's characteristics make it a subject of interest in both synthetic and applied chemistry contexts.
Formula:C23H31NO2
InChI:InChI=1S/C23H31NO2/c1-25-22-11-7-20(8-12-22)15-17-24-21-9-13-23(14-10-21)26-18-16-19-5-3-2-4-6-19/h7-14,19,24H,2-6,15-18H2,1H3
InChI key:InChIKey=RAJWPDPCPAUCGI-UHFFFAOYSA-N
SMILES:N(CCC1=CC=C(OC)C=C1)C2=CC=C(OCCC3CCCCC3)C=C2
Synonyms:
  • Benzeneethanamine, N-[4-(2-cyclohexylethoxy)phenyl]-4-methoxy-
  • N-[4-(2-Cyclohexylethoxy)phenyl]-4-methoxybenzeneethanamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.