
CAS 1040693-44-4
:N-[4-(2-Cyclohexylethoxy)phenyl]-1-naphthaleneethanamine
Description:
N-[4-(2-Cyclohexylethoxy)phenyl]-1-naphthaleneethanamine, identified by its CAS number 1040693-44-4, is a chemical compound that belongs to the class of amines. This substance features a complex structure characterized by a naphthalene backbone, which is fused with an ethylamine group and substituted with a phenyl ring that has a cyclohexylethoxy group. The presence of the cyclohexyl moiety contributes to its hydrophobic characteristics, potentially influencing its solubility and interaction with biological systems. The compound may exhibit interesting pharmacological properties due to its structural features, making it a candidate for research in medicinal chemistry. Its synthesis and characterization would typically involve standard organic chemistry techniques, and its stability, reactivity, and potential applications would be assessed through various analytical methods. As with many organic compounds, safety data sheets should be consulted for handling and storage guidelines, as well as potential toxicity information.
Formula:C26H31NO
InChI:InChI=1S/C26H31NO/c1-2-7-21(8-3-1)18-20-28-25-15-13-24(14-16-25)27-19-17-23-11-6-10-22-9-4-5-12-26(22)23/h4-6,9-16,21,27H,1-3,7-8,17-20H2
InChI key:InChIKey=BMMPBQBURLIWRH-UHFFFAOYSA-N
SMILES:C(CNC1=CC=C(OCCC2CCCCC2)C=C1)C=3C4=C(C=CC3)C=CC=C4
Synonyms:- 1-Naphthaleneethanamine, N-[4-(2-cyclohexylethoxy)phenyl]-
- N-[4-(2-Cyclohexylethoxy)phenyl]-1-naphthaleneethanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.