CAS 104077-15-8
:3-CHLOROCARBONYL-6,7-DIMETHOXY-1-METHYL-2(1H)-QUINOXALINONE
Description:
3-Chlorocarbonyl-6,7-dimethoxy-1-methyl-2(1H)-quinoxalinone is a synthetic organic compound characterized by its complex molecular structure, which includes a quinoxaline core. This compound features a chlorocarbonyl group, which contributes to its reactivity, and two methoxy groups that enhance its solubility and influence its electronic properties. The presence of a methyl group further modifies its steric and electronic characteristics. Typically, quinoxaline derivatives exhibit biological activity, making them of interest in medicinal chemistry. The compound's specific properties, such as melting point, solubility, and spectral characteristics (like NMR and IR), would depend on its molecular interactions and the environment in which it is studied. Additionally, the chlorocarbonyl moiety may impart unique reactivity, potentially allowing for further chemical transformations. Overall, this compound represents a class of heterocyclic compounds that may have applications in pharmaceuticals or agrochemicals, although detailed studies would be necessary to elucidate its full potential and specific applications.
Formula:C12H11ClN2O4
InChI:InChI=1/C12H11ClN2O4/c1-15-7-5-9(19-3)8(18-2)4-6(7)14-10(11(13)16)12(15)17/h4-5H,1-3H3
SMILES:Cn1c2cc(c(cc2nc(C(=O)Cl)c1=O)OC)OC
Synonyms:- 3,4-Dihydro-6,7-Dimethoxy-4-Methyl-3-Oxoquinoxaline-2-Carbonyl Chloride
- 3-Chlorocarbonyl-6,7-Dimethoxy-1-Methyl-2(1H)-Quinoxaline (Dmeq-Cocl)
- 6,7-Dimethoxy-4-Methyl-3-Oxo-3,4-Dihydroquinoxaline-2-Carbonyl Chloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
6,7-Dimethoxy-4-methyl-3-oxo-3,4-dihydroquinoxaline-2-carbonyl Chloride
CAS:Controlled ProductFormula:C12H11ClN2O4Color and Shape:NeatMolecular weight:282.68
