CAS 10408-92-1

1H-Inden-1-amine, N-ethyl-2,3-dihydro-, hydrochloride (1:1)

Description:

1H-Inden-1-amine, N-ethyl-2,3-dihydro-, hydrochloride (1:1), with CAS number 10408-92-1, is a chemical compound characterized by its amine functional group and an ethyl substituent on the nitrogen atom. This compound is a hydrochloride salt, indicating that it is typically encountered in a solid form, often as a white or off-white crystalline powder. The presence of the indene structure contributes to its unique reactivity and potential applications in organic synthesis and medicinal chemistry. As a secondary amine, it may participate in various chemical reactions, including alkylation and acylation. The hydrochloride form enhances its solubility in water, making it more accessible for biological and chemical applications. Additionally, compounds of this nature may exhibit biological activity, which could be of interest in pharmacological research. However, specific safety and handling guidelines should be followed, as with all chemical substances, to mitigate any potential hazards associated with its use.

Formula: C₁₁H₁₅N·ClH

InChI: InChI=1S/C11H15N.ClH/c1-2-12-11-8-7-9-5-3-4-6-10(9)11;/h3-6,11-12H,2,7-8H2,1H3;1H

InChI key: InChIKey=OSRLONJYSAHYIW-UHFFFAOYSA-N

SMILES: N(CC)C1C=2C(CC1)=CC=CC2.Cl

Synonyms:

• 1H-Inden-1-amine, N-ethyl-2,3-dihydro-, hydrochloride (1:1)
• 1-Indanamine, N-ethyl-, hydrochloride
• 1H-Inden-1-amine, N-ethyl-2,3-dihydro-, hydrochloride

N-Ethyl-2,3-dihydro-1H-inden-1-amine hydrochloride

Controlled Product

CAS: 10408-92-1

Versatile small molecule scaffold

Formula: C₁₁H₁₆ClN

Purity: Min. 95%

Molecular weight: 197.7 g/mol

Ref: 3D-KAA40892