CymitQuimica logo

CAS 104089-72-7

:

(2Z)-2-(4-chlorophenyl)-3-(3-nitrophenyl)prop-2-enenitrile

Description:
The chemical substance known as (2Z)-2-(4-chlorophenyl)-3-(3-nitrophenyl)prop-2-enenitrile, with the CAS number 104089-72-7, is an organic compound characterized by its unique structural features. It contains a prop-2-enenitrile backbone, which is a conjugated system that contributes to its reactivity and potential applications in organic synthesis. The presence of a 4-chlorophenyl group and a 3-nitrophenyl group indicates that this compound has significant electron-withdrawing substituents, which can influence its electronic properties and reactivity. The "Z" configuration denotes that the substituents on the double bond are on the same side, affecting its stereochemistry and potentially its biological activity. This compound may exhibit interesting properties such as fluorescence or photochemical behavior due to its conjugated structure. Additionally, the nitro group can impart polar characteristics, making it soluble in various organic solvents. Overall, this compound's unique combination of functional groups and structural features makes it a candidate for further study in fields such as medicinal chemistry and materials science.
Formula:C15H9ClN2O2
InChI:InChI=1/C15H9ClN2O2/c16-14-6-4-12(5-7-14)13(10-17)8-11-2-1-3-15(9-11)18(19)20/h1-9H/b13-8+
Synonyms:
  • benzeneacetonitrile, 4-chloro-alpha-[(3-nitrophenyl)methylene]-, (alphaZ)-
  • m-Nitrobenzylidene-p-chlorophenylacetonitrile
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.