CAS 10409-06-0
:DIPHENYLDISULFONE
Description:
Diphenyldisulfon is an organic compound characterized by its structure, which features two phenyl groups connected by a disulfone functional group. It is typically a white to light yellow crystalline solid with a high melting point. This compound is known for its stability and resistance to thermal degradation, making it suitable for various applications in organic synthesis and materials science. Diphenyldisulfon exhibits good solubility in organic solvents, such as acetone and chloroform, but is less soluble in water. Its chemical properties include the ability to undergo nucleophilic substitution reactions, which can be utilized in the synthesis of other organic compounds. Additionally, diphenyldisulfon is recognized for its potential use as a cross-linking agent in polymer chemistry and as a reagent in the preparation of sulfonamide derivatives. Safety precautions should be observed when handling this compound, as it may pose health risks upon exposure. Overall, diphenyldisulfon is a versatile compound with significant utility in various chemical applications.
Formula:C12H10O4S2
InChI:InChI=1/C12H10O4S2/c13-17(14,11-7-3-1-4-8-11)18(15,16)12-9-5-2-6-10-12/h1-10H
SMILES:c1ccc(cc1)S(=O)(=O)S(=O)(=O)c1ccccc1
Synonyms:- Diphenyl disulfone
- Nsc 232950
- 1,2-Diphenyldisulfane 1,1,2,2-Tetraoxide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
