CAS 104096-15-3

3-PHENYLISONICOTINIC ACID

Description:

3-Phenylisonicotinic acid, with the CAS number 104096-15-3, is a chemical compound that belongs to the class of isonicotinic acids, which are derivatives of pyridine. This compound features a phenyl group attached to the isonicotinic acid structure, which contributes to its unique properties. It typically appears as a solid and is characterized by its aromatic nature due to the presence of the phenyl ring. The compound may exhibit various functional properties, including potential biological activity, making it of interest in medicinal chemistry and pharmaceutical research. Its structure allows for hydrogen bonding and potential interactions with biological targets, which can influence its solubility and reactivity. Additionally, 3-phenylisonicotinic acid may serve as a building block in the synthesis of more complex molecules or as a ligand in coordination chemistry. As with many organic compounds, its stability and reactivity can be influenced by environmental factors such as pH and temperature. Safety data should be consulted for handling and usage, as with any chemical substance.

Formula: C₁₂H₉NO₂

InChI: InChI=1/C12H9NO2/c14-12(15)10-6-7-13-8-11(10)9-4-2-1-3-5-9/h1-8H,(H,14,15)

SMILES: c1ccc(cc1)c1cnccc1C(=O)O

Synonyms:

• 3-Phenylpyridine-4-Carboxylic Acid

3-Phenylisonicotinic acid

CAS: 104096-15-3

Formula: C₁₂H₉NO₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 199.2054

Ref: IN-DA007WJQ

3-Phenylisonicotinic acid

CAS: 104096-15-3

3-Phenylisonicotinic acid

Purity: 95%

Molecular weight: 199.21g/mol

Ref: 54-OR46655

3-Phenylpyridine-4-carboxylic acid

CAS: 104096-15-3

Purity: 97%

Molecular weight: 199.20899963378906

Ref: 10-F608529

3-Phenylisonicotinic Acid

Controlled Product

CAS: 104096-15-3

Applications 3-PHENYLISONICOTINIC ACID (cas# 104096-15-3) is a useful research chemical.

Formula: C₁₂H₉NO₂

Color and Shape: Neat

Molecular weight: 199.2

Ref: TR-P399700