
CAS 104096-91-5
:5-Amino-6-(methylamino)-2(1H)-pyrimidinone
Description:
5-Amino-6-(methylamino)-2(1H)-pyrimidinone, with the CAS number 104096-91-5, is a heterocyclic organic compound characterized by its pyrimidine ring structure, which is a six-membered aromatic ring containing two nitrogen atoms at the 1 and 3 positions. This compound features amino groups at the 5 and 6 positions, contributing to its basicity and potential reactivity. The presence of a methylamino group enhances its solubility in polar solvents and may influence its biological activity. Typically, such compounds are of interest in medicinal chemistry due to their potential as pharmaceutical intermediates or active pharmaceutical ingredients. The molecular structure suggests that it may participate in hydrogen bonding, which can affect its interactions with biological targets. Additionally, the compound's stability, solubility, and reactivity can vary depending on environmental conditions such as pH and temperature, making it a subject of interest for further research in drug development and synthesis.
Formula:C5H8N4O
InChI:InChI=1S/C5H8N4O/c1-7-4-3(6)2-8-5(10)9-4/h2H,6H2,1H3,(H2,7,8,9,10)
InChI key:InChIKey=QHVVJORQMLDIKD-UHFFFAOYSA-N
SMILES:N(C)C1=C(N)C=NC(=O)N1
Synonyms:- NSC 338149
- 2(1H)-Pyrimidinone, 5-amino-4-methylamino-
- 2(1H)-Pyrimidinone, 5-amino-6-(methylamino)-
- 5-Amino-6-(methylamino)-2(1H)-pyrimidinone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.