
CAS 10410-21-6
:3′,4′-Dihydro[2,3′-bifuran]-2′,5′-dione
Description:
3′,4′-Dihydro[2,3′-bifuran]-2′,5′-dione, with the CAS number 10410-21-6, is a chemical compound characterized by its unique bicyclic structure, which consists of two fused furan rings. This compound features a dione functional group, indicating the presence of two carbonyl (C=O) groups within its molecular framework. It is typically a solid at room temperature and may exhibit a range of physical properties such as solubility in organic solvents, depending on its specific molecular interactions. The compound is of interest in various fields, including organic synthesis and materials science, due to its potential applications in the development of pharmaceuticals and agrochemicals. Its reactivity is influenced by the presence of the carbonyl groups, which can participate in various chemical reactions, including nucleophilic additions and cycloadditions. Additionally, the compound may exhibit interesting biological activities, making it a subject of research in medicinal chemistry. As with many organic compounds, handling should be done with care, considering safety data and potential hazards.
Formula:C8H6O4
InChI:InChI=1S/C8H6O4/c9-7-4-5(8(10)12-7)6-2-1-3-11-6/h1-3,5H,4H2
InChI key:InChIKey=NWFDURUFESYTEA-UHFFFAOYSA-N
SMILES:O=C1C(CC(=O)O1)C2=CC=CO2
Synonyms:- [2,3′-Bifuran]-2′,5′-dione, 3′,4′-dihydro-
- 3′,4′-Dihydro[2,3′-bifuran]-2′,5′-dione
- 2-Furansuccinic anhydride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.