CAS 104103-17-5

3-Methoxy-4-nitrobenzeneethanamine

Description:

3-Methoxy-4-nitrobenzeneethanamine, with the CAS number 104103-17-5, is an organic compound characterized by the presence of both methoxy and nitro functional groups attached to a benzene ring. This compound features an ethylamine side chain, which contributes to its amine properties. The methoxy group (-OCH3) typically enhances the compound's solubility in organic solvents and can influence its reactivity, while the nitro group (-NO2) is known for its electron-withdrawing effects, which can affect the compound's overall electronic properties and reactivity in chemical reactions. The presence of these functional groups suggests potential applications in pharmaceuticals or as intermediates in organic synthesis. Additionally, the compound's structure may impart specific physical properties, such as melting and boiling points, which are influenced by intermolecular interactions. Safety and handling precautions should be observed due to the potential toxicity associated with nitro compounds and amines. Overall, 3-Methoxy-4-nitrobenzeneethanamine is a compound of interest in various chemical research and industrial applications.

Formula: C₉H₁₂N₂O₃

InChI: InChI=1S/C9H12N2O3/c1-14-9-6-7(4-5-10)2-3-8(9)11(12)13/h2-3,6H,4-5,10H2,1H3

InChI key: InChIKey=FWWRWPAVNUETPH-UHFFFAOYSA-N

SMILES: O(C)C1=C(N(=O)=O)C=CC(CCN)=C1

Synonyms:

• Benzeneethanamine, 3-methoxy-4-nitro-
• 2-(3-Methoxy-4-nitrophenyl)ethanamine
• 3-Methoxy-4-nitrobenzeneethanamine
• 2-(3-Methoxy-4-nitrophenyl)ethan-1-amine