CymitQuimica logo

CAS 1041054-22-1

:

2-(3,5-Dimethyl-1-piperazinyl)-4-pyrimidinamine

Description:
2-(3,5-Dimethyl-1-piperazinyl)-4-pyrimidinamine, identified by its CAS number 1041054-22-1, is a chemical compound characterized by its unique structural features, which include a pyrimidine ring and a piperazine moiety. This compound typically exhibits properties associated with heterocyclic amines, such as moderate solubility in polar solvents and potential biological activity due to its amine functional groups. The presence of the dimethyl substituents on the piperazine ring can influence its steric and electronic properties, potentially enhancing its interaction with biological targets. Compounds of this nature are often investigated for their pharmacological applications, particularly in the fields of medicinal chemistry and drug development. The specific arrangement of atoms and functional groups can lead to varied reactivity and stability profiles, making it a subject of interest in synthetic chemistry and pharmacology. As with many organic compounds, safety and handling precautions should be observed, given the potential for toxicity or reactivity under certain conditions.
Formula:C10H17N5
InChI:InChI=1S/C10H17N5/c1-7-5-15(6-8(2)13-7)10-12-4-3-9(11)14-10/h3-4,7-8,13H,5-6H2,1-2H3,(H2,11,12,14)
InChI key:InChIKey=IKJAIIQJAGRBKK-UHFFFAOYSA-N
SMILES:CC1CN(CC(C)N1)C=2N=C(N)C=CN2
Synonyms:
  • 4-Pyrimidinamine, 2-(3,5-dimethyl-1-piperazinyl)-
  • 2-(3,5-Dimethylpiperazin-1-yl)pyrimidin-4-amine
  • 2-(3,5-Dimethyl-1-piperazinyl)-4-pyrimidinamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.