CAS 104112-82-5

(13aS)-2,11-dihydroxy-3,10-dimethoxy-7-methyl-5,8,13,13a-tetrahydro-6H-isoquino[3,2-a]isoquinolinium chloride

Description:

The chemical substance known as (13aS)-2,11-dihydroxy-3,10-dimethoxy-7-methyl-5,8,13,13a-tetrahydro-6H-isoquino[3,2-a]isoquinolinium chloride, with CAS number 104112-82-5, is a complex organic compound characterized by its unique isoquinoline structure. This compound features multiple functional groups, including hydroxyl (-OH) and methoxy (-OCH3) groups, which contribute to its potential biological activity and solubility properties. The presence of a quaternary ammonium structure indicates that it may exhibit ionic characteristics, influencing its interaction with biological membranes and receptors. The stereochemistry, denoted by the (13aS) configuration, suggests specific spatial arrangements that can affect the compound's pharmacological properties. Such compounds are often investigated for their potential therapeutic applications, particularly in the fields of medicinal chemistry and pharmacology. Overall, the intricate structure and functional groups of this substance suggest a diverse range of chemical behaviors and potential uses in various scientific fields.

Formula: C₂₀H₂₄ClNO₄

InChI: InChI=1/C20H23NO4.ClH/c1-21-5-4-12-8-19(24-2)18(23)10-15(12)16(21)6-13-7-17(22)20(25-3)9-14(13)11-21;/h7-10,16H,4-6,11H2,1-3H3,(H-,22,23);1H/t16-,21?;/m0./s1

SMILES: C[N+]12CCc3cc(c(cc3[C@@H]2Cc2cc(c(cc2C1)OC)O)[O-])OC.Cl

Phellodendrine Hydrochloride

CAS: 104112-82-5

Formula: C₂₀H₂₄ClNO₄

Purity: 98%

Color and Shape: Solid

Molecular weight: 377.8619

Ref: IN-DA008UYQ

Phellodendrine Chloride

CAS: 104112-82-5

Phellodendrine Chloride

Purity: 98%

Molecular weight: 377.86g/mol

Ref: 54-OR1026452

Phellodendrine chloride

CAS: 104112-82-5

Phellodendrine chloride

Purity: ≥98%

Molecular weight: 377.86g/mol

Ref: 54-BUP05944

Phellodendrine chloride

CAS: 104112-82-5

Formula: C₂₀H₂₄CLNO₄

Molecular weight: 377.87

Ref: 7W-GY7126

Phellodendrine chloride

CAS: 104112-82-5

Phellodendrine chloride has anti-nephritic activity, may be due to its ability to inhibit the proliferation or the migration of macrophages and cytotoxic T lymphocytes in the glomeruli.

Formula: C₂₀H₂₄NO₄

Purity: 95%~99%

Molecular weight: 342.414

Ref: BP-BP1084

Phellodendrine chloride

CAS: 104112-82-5

Phellodendrine chloride combats kidney inflammation by blocking macrophage and T cell activity in glomeruli.

Formula: C₂₀H₂₄ClNO₄

Purity: 98.85% - 99.05%

Color and Shape: Solid

Molecular weight: 377.86

Ref: TM-T5S0777

Phellodendrine chloride

CAS: 104112-82-5

Natural alkaloid

Formula: C₂₀H₂₄NO₄Cl

Purity: ≥ 98.0 % (HPLC)

Color and Shape: Powder

Molecular weight: 377.87

Ref: 5G-83531

Phellodendrine Chloride

Controlled Product

CAS: 104112-82-5

Formula: C₂₀H₂₄ClNO₄

Color and Shape: Neat

Molecular weight: 377.87

Ref: TR-P294565