CAS 104112-82-5: (13aS)-2,11-dihydroxy-3,10-dimethoxy-7-methyl-5,8,13,13a-tetrahydro-6H-isoquino[3,2-a]isoquinolinium chloride
Description:The chemical substance known as (13aS)-2,11-dihydroxy-3,10-dimethoxy-7-methyl-5,8,13,13a-tetrahydro-6H-isoquino[3,2-a]isoquinolinium chloride, with CAS number 104112-82-5, is a complex organic compound characterized by its unique isoquinoline structure. This compound features multiple functional groups, including hydroxyl (-OH) and methoxy (-OCH3) groups, which contribute to its potential biological activity and solubility properties. The presence of a quaternary ammonium structure indicates that it may exhibit ionic characteristics, influencing its interaction with biological membranes and receptors. The stereochemistry, denoted by the (13aS) configuration, suggests specific spatial arrangements that can affect the compound's pharmacological properties. Such compounds are often investigated for their potential therapeutic applications, particularly in the fields of medicinal chemistry and pharmacology. Overall, the intricate structure and functional groups of this substance suggest a diverse range of chemical behaviors and potential uses in various scientific fields.
Formula:C20H24ClNO4
InChI:InChI=1/C20H23NO4.ClH/c1-21-5-4-12-8-19(24-2)18(23)10-15(12)16(21)6-13-7-17(22)20(25-3)9-14(13)11-21;/h7-10,16H,4-6,11H2,1-3H3,(H-,22,23);1H/t16-,21?;/m0./s1