CymitQuimica logo

CAS 10413-00-0

:

5-oxo-5-phenylpentanenitrile

Description:
5-Oxo-5-phenylpentanenitrile, with the CAS number 10413-00-0, is an organic compound characterized by its functional groups, including a nitrile (-C≡N) and a ketone (C=O) within a pentane chain. This compound features a phenyl group, which contributes to its aromatic properties and can influence its reactivity and solubility. Typically, compounds like this exhibit moderate polarity due to the presence of both the nitrile and ketone groups, which can engage in hydrogen bonding and dipole-dipole interactions. The molecular structure suggests that it may participate in various chemical reactions, such as nucleophilic additions or substitutions, making it of interest in synthetic organic chemistry. Additionally, its physical properties, such as boiling point and solubility, would depend on the specific arrangement of atoms and the presence of functional groups. Overall, 5-oxo-5-phenylpentanenitrile is a versatile compound that can serve as an intermediate in the synthesis of more complex organic molecules.
Formula:C11H11NO
InChI:InChI=1/C11H11NO/c12-9-5-4-8-11(13)10-6-2-1-3-7-10/h1-3,6-7H,4-5,8H2
SMILES:c1ccc(cc1)C(=O)CCCC#N
Synonyms:
  • Benzenepentanenitrile, Delta-Oxo-
  • 5-Oxo-5-phenylpentanenitrile
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.