CAS 104135-57-1

Methanone, (4-chlorophenyl)(4-hydroxyphenyl)-, homopolymer

Description:

Methanone, (4-chlorophenyl)(4-hydroxyphenyl)-, homopolymer, also known by its CAS number 104135-57-1, is a synthetic polymer characterized by its structural composition, which includes chlorophenyl and hydroxyphenyl groups. This polymer exhibits properties typical of phenolic compounds, such as thermal stability and resistance to degradation. The presence of the chlorophenyl group can enhance its chemical resistance and alter its solubility characteristics, while the hydroxyphenyl group contributes to potential hydrogen bonding and increased reactivity. The polymer is likely to have applications in coatings, adhesives, and composites due to its mechanical strength and durability. Additionally, its unique functional groups may allow for further chemical modifications, making it versatile in various industrial applications. Safety and handling precautions should be observed, as with many synthetic polymers, to mitigate any potential health risks associated with exposure. Overall, this polymer represents a class of materials with significant utility in advanced material science and engineering applications.

Formula: (C₁₃H₉ClO₂)x

InChI: InChI=1S/C13H9ClO2/c14-11-5-1-9(2-6-11)13(16)10-3-7-12(15)8-4-10/h1-8,15H

InChI key: InChIKey=RUETVLNXAGWCDS-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC=C(Cl)C=C1)C2=CC=C(O)C=C2

Synonyms:

• 4-Chloro-4′-hydroxy benzophenone homopolymer
• Methanone, (4-chlorophenyl)(4-hydroxyphenyl)-, homopolymer

Methanone, (4-chlorophenyl)(4-hydroxyphenyl)-, homopolymer

CAS: 104135-57-1

Formula: C₁₃H₉ClO₂

Molecular weight: 232.6624

Ref: IN-DA01X3OY