CAS 1041420-54-5
:Poly(oxy-1,2-ethanediyl), α-(1-oxododecyl)-ω-[3-(triethoxysilyl)propoxy]-
Description:
Poly(oxy-1,2-ethanediyl), α-(1-oxododecyl)-ω-[3-(triethoxysilyl)propoxy]- is a complex amphiphilic compound characterized by its dual functionality, combining hydrophilic poly(ethylene glycol) segments with hydrophobic alkyl chains and silane groups. This structure imparts unique properties, making it suitable for various applications, including as a surfactant, emulsifier, or coupling agent in formulations. The presence of the triethoxysilyl group enhances its ability to bond with inorganic surfaces, facilitating adhesion and improving compatibility in composite materials. The dodecyl chain contributes to its hydrophobic characteristics, while the ethylene glycol units provide solubility in aqueous environments. This compound is often utilized in the development of advanced materials, coatings, and in the modification of surfaces to enhance properties such as wettability and stability. Its versatility is further augmented by the ability to tailor its molecular weight and functional groups, allowing for customization in specific applications across industries such as pharmaceuticals, cosmetics, and materials science.
Formula:(C2H4O)nC21H44O5Si
InChI:InChI=1S/C23H48O6Si/c1-5-9-10-11-12-13-14-15-16-18-23(24)26-21-20-25-19-17-22-30(27-6-2,28-7-3)29-8-4/h5-22H2,1-4H3
InChI key:InChIKey=IIHYFKDTIZFKNT-UHFFFAOYSA-N
SMILES:[Si](CCCOCCOC(CCCCCCCCCCC)=O)(OCC)(OCC)OCC
Synonyms:- TRIETHOXYSILYLPROPOXY(POLYETHYLENEOXY)DODECANOATE,tech-95
- Poly(oxy-1,2-ethanediyl), α-(1-oxododecyl)-ω-[3-(triethoxysilyl)propoxy]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.