CAS 1041434-82-5: Cyclopentanecarboxylic acid, 3-[(1S)-1-(acetylamino)-2-ethylbutyl]-4-[(aminoiminomethyl)amino]-2-hydroxy-, hydrate (1:3), (1S,2S,3R,4R)-
Description:Cyclopentanecarboxylic acid, 3-[(1S)-1-(acetylamino)-2-ethylbutyl]-4-[(aminoiminomethyl)amino]-2-hydroxy-, hydrate (1:3), (1S,2S,3R,4R)- is a complex organic compound characterized by its cyclopentane ring structure, which is substituted with various functional groups including a carboxylic acid, hydroxyl, and amino groups. The presence of the acetylamino and ethylbutyl substituents indicates that it has both hydrophilic and hydrophobic characteristics, potentially influencing its solubility and reactivity. The specific stereochemistry denoted by the (1S,2S,3R,4R) configuration suggests that the compound has multiple chiral centers, which can significantly affect its biological activity and interactions. As a hydrate, it also contains water molecules in its structure, which may impact its stability and solubility in different solvents. Overall, this compound's unique structural features make it of interest in various fields, including medicinal chemistry and biochemistry, where it may serve as a potential pharmaceutical agent or biochemical probe.
Formula:C15H28N4O4·3H2O
InChI:InChI=1S/C15H28N4O4.3H2O/c1-4-8(5-2)12(18-7(3)20)11-10(19-15(16)17)6-9(13(11)21)14(22)23;;;/h8-13,21H,4-6H2,1-3H3,(H,18,20)(H,22,23)(H4,16,17,19);3*1H2/t9-,10+,11+,12-,13+;;;/m0.../s1
InChI key:InChIKey=RFUCJKFZFXNIGB-ZBBHRWOZSA-N
SMILES:O=C(O)C1CC(NC(=N)N)C(C1O)C(NC(=O)C)C(CC)CC.O
- Synonyms:
- (1S,2S,3S,4R)-3-[(1S)-1-Acetamido-2-ethylbutyl]-4-[(diaminomethylene)amino]-2-hydroxycyclopentanecarboxylic acid trihydrate
- BCX 1812 trihydrate
- Cyclopentanecarboxylic acid, 3-[(1S)-1-(acetylamino)-2-ethylbutyl]-4-[(aminoiminomethyl)amino]-2-hydroxy-, hydrate (1:3), (1S,2S,3R,4R)-
- RWJ 270201 trihydrate
- Rapiacta trihydrate
- Peramivir trihydrate