CAS 1041437-99-3

N-[(3-Chloro-4-fluorophenyl)sulfonyl]-L-leucine

Description:

N-[(3-Chloro-4-fluorophenyl)sulfonyl]-L-leucine is a chemical compound characterized by its unique structure, which includes a leucine amino acid backbone modified by a sulfonyl group attached to a phenyl ring that is further substituted with chlorine and fluorine atoms. This compound typically exhibits properties associated with both amino acids and sulfonyl derivatives, such as potential solubility in polar solvents and the ability to participate in various chemical reactions due to the presence of functional groups. The chlorofluorophenyl moiety may impart specific biological activity, making it of interest in pharmaceutical research, particularly in the development of targeted therapies. Additionally, the presence of the sulfonyl group can enhance the compound's stability and reactivity. As with many such compounds, its behavior in biological systems, including interactions with proteins or enzymes, would be a key area of study, potentially influencing its application in medicinal chemistry. Safety and handling precautions should be observed due to the presence of halogenated groups, which can pose environmental and health risks.

Formula: C₁₂H₁₅ClFNO₄S

InChI: InChI=1S/C12H15ClFNO4S/c1-7(2)5-11(12(16)17)15-20(18,19)8-3-4-10(14)9(13)6-8/h3-4,6-7,11,15H,5H2,1-2H3,(H,16,17)/t11-/m0/s1

InChI key: InChIKey=UICILYMJVHXSFN-NSHDSACASA-N

SMILES: S(N[C@@H](CC(C)C)C(O)=O)(=O)(=O)C1=CC(Cl)=C(F)C=C1

Synonyms:

• L-Leucine, N-[(3-chloro-4-fluorophenyl)sulfonyl]-
• N-[(3-Chloro-4-fluorophenyl)sulfonyl]-L-leucine

((3-chloro-4-fluorophenyl)sulfonyl)leucine

CAS: 1041437-99-3

Formula: C₁₂H₁₅ClFNO₄S

Purity: 95.0%

Molecular weight: 323.76

Ref: 10-F494661