CymitQuimica logo

CAS 104147-77-5

:

3-Chloro-1-(5-fluoro-2-hydroxyphenyl)-1-propanone

Description:
3-Chloro-1-(5-fluoro-2-hydroxyphenyl)-1-propanone, with the CAS number 104147-77-5, is an organic compound characterized by its unique functional groups and structural features. It contains a chloro substituent and a fluorinated phenolic moiety, which contribute to its chemical reactivity and potential biological activity. The presence of the ketone functional group indicates that it can participate in various chemical reactions, such as nucleophilic additions. The hydroxyl group on the phenyl ring enhances its polarity and solubility in polar solvents, while the fluorine atom can influence the compound's lipophilicity and metabolic stability. This compound may be of interest in medicinal chemistry and pharmaceutical research due to its structural characteristics, which could lead to the development of novel therapeutic agents. Additionally, its synthesis and reactivity can be explored in the context of organic synthesis and material science. Overall, 3-Chloro-1-(5-fluoro-2-hydroxyphenyl)-1-propanone presents a versatile framework for further chemical exploration and application.
Formula:C9H8ClFO2
InChI:InChI=1S/C9H8ClFO2/c10-4-3-9(13)7-5-6(11)1-2-8(7)12/h1-2,5,12H,3-4H2
InChI key:InChIKey=JBCKVAMFAGXGNH-UHFFFAOYSA-N
SMILES:C(CCCl)(=O)C1=C(O)C=CC(F)=C1
Synonyms:
  • 3-Chloro-1-(5-fluoro-2-hydroxyphenyl)-1-propanone
  • 1-Propanone, 3-chloro-1-(5-fluoro-2-hydroxyphenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.