
CAS 104163-35-1
:3-Methylthiophene-2-methylamine
Description:
3-Methylthiophene-2-methylamine is an organic compound characterized by the presence of both a thiophene ring and an amine functional group. The thiophene ring, a five-membered aromatic heterocycle containing sulfur, contributes to the compound's aromaticity and potential reactivity. The methyl groups attached to the thiophene and the amine group enhance its hydrophobic characteristics and influence its solubility in organic solvents. This compound is likely to exhibit basic properties due to the presence of the amine group, which can accept protons. Additionally, the structure suggests potential applications in organic synthesis and as a building block in pharmaceuticals or agrochemicals. Its specific reactivity and interactions would depend on the surrounding chemical environment and the presence of other functional groups. Safety data and handling precautions should be considered, as with any chemical substance, to ensure proper usage and minimize risks.
Formula:C6H9NS
InChI:InChI=1/C6H9NS/c1-5-2-3-8-6(5)4-7/h2-3H,4,7H2,1H3
SMILES:Cc1ccsc1CN
Synonyms:- 2-Aminomethyl-3-methylthiophene
- (3-Methyl-2-thienyl)methylamine
- 1-(3-Methylthiophen-2-Yl)Methanamine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3-Methylthiophene-2-methylamine, 96%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C6H9NSPurity:96%Color and Shape:Clear colorless to yellow to orange, LiquidMolecular weight:127.212-(Aminomethyl)-3-methylthiophene
CAS:<p>2-(Aminomethyl)-3-methylthiophene</p>Formula:C6H9NSPurity:90%Color and Shape:LiquidMolecular weight:127.21g/mol1-(3-Methyl-2-thienyl)methanamine
CAS:Formula:C6H9NSPurity:95.0%Color and Shape:LiquidMolecular weight:127.21



