CAS 10417-94-4: Timnodonic acid
Description:Timnodonic acid, also known as 11-hexadecenoic acid, is a long-chain unsaturated fatty acid characterized by its specific molecular structure, which includes a double bond in the alkyl chain. It is typically found in certain marine organisms and is notable for its potential biological activities. The presence of the double bond contributes to its reactivity and influences its physical properties, such as melting point and solubility. Timnodonic acid is of interest in various fields, including biochemistry and nutrition, due to its role in cellular processes and potential health benefits. It may also serve as a precursor for the synthesis of other bioactive compounds. Additionally, its unique structure makes it a subject of study in the context of lipid metabolism and the development of functional foods. As with many fatty acids, its behavior in biological systems can be influenced by factors such as chain length and degree of unsaturation, making it a valuable compound for research in lipid chemistry.
Formula:C20H30O2
InChI:InChI=1S/C20H30O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22/h3-4,6-7,9-10,12-13,15-16H,2,5,8,11,14,17-19H2,1H3,(H,21,22)/b4-3-,7-6-,10-9-,13-12-,16-15-
InChI key:InChIKey=JAZBEHYOTPTENJ-JLNKQSITSA-N
SMILES:O=C(O)CCCC=CCC=CCC=CCC=CCC=CCC
- Synonyms:
- (5Z,8Z,11Z,14Z,17Z)-5,8,11,14,17-Eicosapentaenoic acid
- (5Z,8Z,11Z,14Z,17Z)-Eicosa-5,8,11,14,17-pentaenoic acid
- (5Z,8Z,11Z,14Z,17Z)-Eicosapentaenoic acid
- (5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoic acid
- (all-Z)-5,8,11,14,17-Eicosapentaenoic acid
- (all-Z)-Δ5,8,11,14,17-Eicosapentaenoic acid
- (all-Z)-Δ<sup>5,8,11,14,17</sup>-Eicosapentaenoic acid
- (all-cis)-5,8,11,14,17-Eicosapentaenoic acid
- 5,8,11,14,17-Eicosapentaenoic acid
- 5,8,11,14,17-Eicosapentaenoic acid, (5Z,8Z,11Z,14Z,17Z)-
- See more synonyms
- 5,8,11,14,17-Eicosapentaenoic acid, (all-Z)-
- C20:5 (All Cis-5,8,11,14,17) Acid
- C20:5 Omega-3
- Eicosa-5Z,8Z,11Z,14Z,17Z-Pentaenoic Acid
- Eicosapentaenoic Acid
- Eicosapentaenoic Cid
- Epa 45G
- Eye-Q
- Icosapent
- Icosapentaenoic acid
- Incromega E 7010SR
- PlusEPA
- Ropufa 70
- Timnodonic Acid
- cis-5,8,11,14,17-Eicosapentaenoic acid
- o 3Mega+ Joy