CAS 104174-12-1
:α-Ethyl-2,5-dimethylbenzenemethanol
Description:
α-Ethyl-2,5-dimethylbenzenemethanol, with the CAS number 104174-12-1, is an organic compound characterized by its aromatic structure and the presence of both ethyl and methyl substituents on the benzene ring. This compound features a hydroxyl (-OH) functional group, which classifies it as an alcohol. The presence of multiple alkyl groups contributes to its hydrophobic nature, influencing its solubility in organic solvents rather than in water. The compound's molecular structure suggests potential applications in the synthesis of fragrances, flavoring agents, or as an intermediate in organic synthesis. Its physical properties, such as boiling point, melting point, and density, would typically be influenced by the steric effects of the substituents and the overall molecular weight. Additionally, the compound may exhibit specific reactivity patterns typical of alcohols, including oxidation and esterification. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C11H16O
InChI:InChI=1S/C11H16O/c1-4-11(12)10-7-8(2)5-6-9(10)3/h5-7,11-12H,4H2,1-3H3
InChI key:InChIKey=VHFHVLYXKPLTID-UHFFFAOYSA-N
SMILES:C(CC)(O)C1=C(C)C=CC(C)=C1
Synonyms:- α-Ethyl-2,5-dimethylbenzenemethanol
- Benzyl alcohol, α-ethyl-2,5-dimethyl-
- 1-(2,5-Dimethylphenyl)-1-propanol
- 1-(2,5-Dimethylphenyl)propan-1-ol
- Benzenemethanol, α-ethyl-2,5-dimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.