CAS 1041853-22-8

6-Bromo-7-ethoxy-4-hydroxy-3-cinnolinecarboxylic acid

Description:

6-Bromo-7-ethoxy-4-hydroxy-3-cinnolinecarboxylic acid is a chemical compound characterized by its unique structure, which includes a cinnoline core substituted with a bromine atom, an ethoxy group, and a hydroxy group. This compound is likely to exhibit properties typical of aromatic compounds, such as stability and potential for various chemical reactions due to the presence of functional groups. The bromine substituent may enhance its reactivity, particularly in electrophilic substitution reactions. The hydroxy group contributes to its potential solubility in polar solvents and may also participate in hydrogen bonding, influencing its biological activity. The ethoxy group can affect the lipophilicity of the molecule, potentially impacting its pharmacokinetic properties if considered for medicinal applications. Overall, the combination of these functional groups suggests that 6-Bromo-7-ethoxy-4-hydroxy-3-cinnolinecarboxylic acid may possess interesting biological activities, making it a candidate for further research in medicinal chemistry and related fields.

Formula: C₁₁H₉BrN₂O₄

InChI: InChI=1S/C11H9BrN2O4/c1-2-18-8-4-7-5(3-6(8)12)10(15)9(11(16)17)14-13-7/h3-4H,2H2,1H3,(H,13,15)(H,16,17)

InChI key: InChIKey=PBCCPBVPMNOYLM-UHFFFAOYSA-N

SMILES: OC=1C2=C(C=C(OCC)C(Br)=C2)N=NC1C(O)=O

Synonyms:

• 6-Bromo-7-ethoxy-4-hydroxy-3-cinnolinecarboxylic acid
• 3-Cinnolinecarboxylic acid, 6-bromo-7-ethoxy-4-hydroxy-