
CAS 1041853-23-9
:6-Bromo-4-hydroxy-7-(2-methoxyethoxy)-3-cinnolinecarboxylic acid
Description:
6-Bromo-4-hydroxy-7-(2-methoxyethoxy)-3-cinnolinecarboxylic acid is a chemical compound characterized by its complex structure, which includes a bromine atom, a hydroxyl group, and a cinnoline moiety. The presence of the bromine substituent typically enhances the compound's reactivity and may influence its biological activity. The hydroxyl group contributes to the compound's potential solubility in polar solvents and may participate in hydrogen bonding, affecting its interactions in biological systems. The 2-methoxyethoxy group adds to the compound's hydrophilicity and steric bulk, which can impact its pharmacokinetic properties. This compound may exhibit various biological activities, making it of interest in medicinal chemistry and drug development. Its unique structural features suggest potential applications in therapeutic contexts, although specific biological activities would require empirical investigation. Overall, the characteristics of this compound highlight its potential utility in research and development within the fields of organic and medicinal chemistry.
Formula:C12H11BrN2O5
InChI:InChI=1S/C12H11BrN2O5/c1-19-2-3-20-9-5-8-6(4-7(9)13)11(16)10(12(17)18)15-14-8/h4-5H,2-3H2,1H3,(H,14,16)(H,17,18)
InChI key:InChIKey=MKKPCCLMQWZWIM-UHFFFAOYSA-N
SMILES:OC=1C2=C(C=C(OCCOC)C(Br)=C2)N=NC1C(O)=O
Synonyms:- 6-Bromo-4-hydroxy-7-(2-methoxyethoxy)-3-cinnolinecarboxylic acid
- 3-Cinnolinecarboxylic acid, 6-bromo-4-hydroxy-7-(2-methoxyethoxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
6-Bromo-4-hydroxy-7-(2-methoxyethoxy)cinnoline-3-carboxylic acid
CAS:Formula:C12H11BrN2O5Molecular weight:343.1301
