CymitQuimica logo

CAS 104195-80-4

:

(2S,3S)-2-Amino-3-methoxybutanoic acid

Description:
(2S,3S)-2-Amino-3-methoxybutanoic acid, also known as a derivative of the amino acid L-threonine, is characterized by its chiral centers at the second and third carbon atoms, which contribute to its specific stereochemistry. This compound features an amino group (-NH2), a carboxylic acid group (-COOH), and a methoxy group (-OCH3) attached to a four-carbon backbone. The presence of the methoxy group enhances its solubility in polar solvents and may influence its biological activity. As an amino acid derivative, it plays a role in various biochemical processes, potentially acting as a building block for proteins or as a precursor for other bioactive molecules. Its stereochemistry is crucial for its interaction with biological systems, as enantiomers can exhibit different properties and activities. The compound's CAS number, 104195-80-4, allows for its identification in chemical databases, facilitating research and application in fields such as pharmaceuticals, biochemistry, and nutrition.
Formula:C5H11NO3
InChI:InChI=1/C5H11NO3/c1-3(9-2)4(6)5(7)8/h3-4H,6H2,1-2H3,(H,7,8)/t3-,4-/m0/s1
InChI key:FYCWLJLGIAUCCL-IMJSIDKUSA-N
SMILES:C[C@@H]([C@@H](C(=O)O)N)OC
Synonyms:
  • dl-Erythro-O-methylthreonine
  • L-allothreonine, O-methyl-
  • O-Methyl-L-allothreonine
Found 5 products.