CAS 104197-13-9
:4-BROMO-2,6-DIFLUOROPHENOL
Description:
4-Bromo-2,6-difluorophenol is an organic compound characterized by its aromatic structure, which includes a phenolic hydroxyl group (-OH) and halogen substituents. Specifically, it features a bromine atom at the para position and two fluorine atoms at the ortho positions relative to the hydroxyl group on the benzene ring. This substitution pattern influences its chemical reactivity and physical properties, such as solubility and boiling point. The presence of electronegative halogens like bromine and fluorine enhances the compound's acidity compared to unsubstituted phenols, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. Additionally, the compound may exhibit interesting biological activities, which could be explored in pharmaceutical applications. Its CAS number, 104197-13-9, allows for easy identification in chemical databases. As with many halogenated compounds, safety precautions should be taken when handling 4-bromo-2,6-difluorophenol due to potential toxicity and environmental concerns.
Formula:C6H3BrF2O
InChI:InChI=1/C6H3BrF2O/c7-3-1-4(8)6(10)5(9)2-3/h1-2,10H
SMILES:c1c(cc(c(c1F)O)F)Br
Synonyms:- 2,6-Difluoro-4-Bromophenol 4-Bromo-2,6-Difluoro Phenol
- 2,6-Difluoro-4-bromophenol
- 4-Bromo-2,6-difluorophenol 98%
- 4-Bromo-2,6-difluorophenol98%
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4-BROMO-2,6-DIFLUOROPHENOL
CAS:Formula:C6H3BrF2OPurity:97%Color and Shape:SolidMolecular weight:208.98824-Bromo-2,6-difluorophenol
CAS:<p>4-Bromo-2,6-difluorophenol</p>Formula:C6H3BrF2OPurity:97%Color and Shape: white to off white crystalline solidMolecular weight:208.99g/mol4-Bromo-2,6-difluorophenol
CAS:<p>4-Bromo-2,6-difluorophenol is a hydrophobic organic molecule that has a metallization property when it comes in contact with pyridine. This compound can be used as a research tool to study the magnetic properties of the molecule. The large-scale synthesis of this molecule can be achieved through an oxidation reaction. 4-Bromo-2,6-difluorophenol has a shift in its nmr spectra and anisotropy in its magnetic properties, which are due to hydrogen bonding and fluorine substitution.</p>Formula:C6H3BrF2OPurity:Min. 95%Color and Shape:PowderMolecular weight:208.99 g/mol4-Bromo-2,6-difluorophenol
CAS:Formula:C6H3BrF2OPurity:97%Color and Shape:Low Melting Solid, Low-melting solidMolecular weight:208.99



