CAS 1042-35-9

4-(Cyclohexylamino)-1-(phenylmethyl)-4-piperidinecarboxamide

Description:

4-(Cyclohexylamino)-1-(phenylmethyl)-4-piperidinecarboxamide, with CAS number 1042-35-9, is a chemical compound that belongs to the class of piperidine derivatives. This substance features a piperidine ring substituted with a cyclohexylamino group and a phenylmethyl group, contributing to its unique structural and functional properties. It is characterized by its potential biological activity, often explored in medicinal chemistry for its effects on the central nervous system. The presence of the piperidine moiety suggests possible interactions with neurotransmitter receptors, making it of interest in pharmacological studies. Additionally, the compound may exhibit varying solubility in organic solvents and water, influenced by its functional groups. Its molecular structure allows for potential applications in drug development, particularly in the treatment of neurological disorders. However, specific physical and chemical properties such as melting point, boiling point, and solubility would require empirical data for precise characterization. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.

Formula: C₁₉H₂₉N₃O

InChI: InChI=1S/C19H29N3O/c20-18(23)19(21-17-9-5-2-6-10-17)11-13-22(14-12-19)15-16-7-3-1-4-8-16/h1,3-4,7-8,17,21H,2,5-6,9-15H2,(H2,20,23)

InChI key: InChIKey=WVWNBANESWUIBO-UHFFFAOYSA-N

SMILES: N(C1(C(N)=O)CCN(CC2=CC=CC=C2)CC1)C3CCCCC3

Synonyms:

• 1-Benzyl-4-(cyclohexylamino)piperidine-4-carboxamide
• 4-(Cyclohexylamino)-1-(phenylmethyl)-4-piperidinecarboxamide
• 4-Piperidinecarboxamide, 4-(cyclohexylamino)-1-(phenylmethyl)-
• Isonipecotamide, 1-benzyl-4-(cyclohexylamino)-
• NSC 73007