CAS 10420-63-0: N-(2,4-Dinitrophenyl)-L-alanine methyl ester
Description:N-(2,4-Dinitrophenyl)-L-alanine methyl ester, with the CAS number 10420-63-0, is a chemical compound that serves as a derivative of the amino acid L-alanine. This compound features a dinitrophenyl group, which is known for its strong electron-withdrawing properties, contributing to the compound's reactivity and potential applications in biochemical assays. It is typically used in the study of enzyme kinetics and protein interactions due to its ability to form stable conjugates with amino acids and proteins. The presence of the methyl ester group enhances its solubility in organic solvents, making it suitable for various laboratory applications. The compound is characterized by its yellow color, attributed to the dinitrophenyl moiety, and it is sensitive to light and moisture. As with many dinitrophenyl compounds, it may pose health risks, including toxicity and potential carcinogenicity, necessitating careful handling and appropriate safety measures in laboratory settings.
Formula:C10H11N3O6
InChI:InChI=1/C10H11N3O6/c1-6(10(14)19-2)11-8-4-3-7(12(15)16)5-9(8)13(17)18/h3-6,11H,1-2H3/t6-/m0/s1
- Synonyms:
- H-Phe[2,4-(NO_2)_2]-OMe
- methyl N-(2,4-dinitrophenyl)-L-alaninate
| Brand | Product data | Purity | Price range | Estimated delivery |
|---|---|---|---|---|
 | N-(2,4-Dinitrophenyl)-L-alanine Methyl Ester REF: 3B-D2135CAS: 10420-63-0 | >98.0%(HPLC) | 75.00 € | Mon 07 Apr 25 |
 | N-(2,4-DINITROPHENYL)-L-ALANINE METHYL ESTER REF: IN-DA003S83CAS: 10420-63-0 | 98.0% | 118.00 €~163.00 € | Mon 14 Apr 25 |
 | N-(2,4-Dinitrophenyl)-L-alanine Methyl Ester REF: 10-F634894CAS: 10420-63-0 | 98% | To inquire | Thu 24 Apr 25 |
| methyl N-(2,4-dinitrophenyl)alaninate REF: 10-F373862CAS: 10420-63-0 | >98.0%(HPLC) | - - - | Discontinued product |
 | N-(2,4-Dinitrophenyl)-L-alanine Methyl Ester REF: 3D-FD62435CAS: 10420-63-0 | Min. 95% | - - - | Discontinued product |
N-(2,4-Dinitrophenyl)-L-alanine Methyl Ester
Ref: 3B-D2135
| 1g | 75.00 € |
N-(2,4-DINITROPHENYL)-L-ALANINE METHYL ESTER
Ref: IN-DA003S83
| 1g | 118.00 € |
N-(2,4-Dinitrophenyl)-L-alanine Methyl Ester
Ref: 10-F634894
| 1g | To inquire |
Ref: 10-F373862
| 1g | Discontinued | Request information |
N-(2,4-Dinitrophenyl)-L-alanine Methyl Ester
Ref: 3D-FD62435
| 1g | Discontinued | Request information | |
| 2g | Discontinued | Request information | |
| 5g | Discontinued | Request information | |
| 10g | Discontinued | Request information | |
| 25g | Discontinued | Request information |
