CAS 10420-73-2
:6-chloroflavone
Description:
6-Chloroflavone is a synthetic organic compound belonging to the flavonoid class, characterized by its distinct flavone backbone, which consists of a benzopyrone structure. The presence of a chlorine atom at the 6-position of the flavone ring system is a notable feature that influences its chemical properties and biological activity. This compound typically exhibits a yellow to orange color, which is common among flavonoids due to their conjugated double bond systems that allow for light absorption. 6-Chloroflavone is known for its potential biological activities, including antioxidant, anti-inflammatory, and anticancer properties, making it of interest in pharmacological research. Its solubility can vary depending on the solvent, and it may exhibit moderate stability under standard conditions. The compound can be analyzed using various techniques such as UV-Vis spectroscopy, NMR, and mass spectrometry, which help in understanding its structure and reactivity. Overall, 6-chloroflavone serves as a valuable compound in both synthetic chemistry and biological studies.
Formula:C15H9ClO2
InChI:InChI=1/C15H9ClO2/c16-11-6-7-14-12(8-11)13(17)9-15(18-14)10-4-2-1-3-5-10/h1-9H
SMILES:c1ccc(cc1)c1cc(=O)c2cc(ccc2o1)Cl
Synonyms:- 6-chloro-2-phenyl-4H-chromen-4-one
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
6-Chloroflavone
CAS:Formula:C15H9ClO2Purity:>98.0%(GC)Color and Shape:White to Light yellow to Light orange powder to crystalMolecular weight:256.696-Chloroflavone
CAS:<p>6-Chloroflavone is a synthetic flavonoid derivative, which is a modified chemical compound originating from naturally occurring flavonoids found in various plants. Structurally, it is characterized by the substitution of a chlorine atom at the 6th position on the flavone backbone. This chemical modification is designed to alter its physicochemical properties and enhance its biological activity.</p>Formula:C15H9ClO2Purity:Min. 95%Molecular weight:256.68 g/mol




