CAS 1042153-28-5

1,1-Difluoro-3-(iodomethyl)cyclopentane

Description:

1,1-Difluoro-3-(iodomethyl)cyclopentane is a halogenated organic compound characterized by the presence of two fluorine atoms and one iodomethyl group attached to a cyclopentane ring. The molecular structure features a cyclopentane backbone, which is a five-membered carbon ring, with the difluoro substituents located at the first carbon and the iodomethyl group at the third carbon. This compound is typically colorless to pale yellow and may exhibit a distinct odor. Its physical properties, such as boiling and melting points, are influenced by the halogen substituents, which can enhance its reactivity and polarity. The presence of fluorine and iodine atoms suggests that it may participate in various chemical reactions, including nucleophilic substitutions and radical reactions. Additionally, the compound's unique structure may confer specific applications in organic synthesis, pharmaceuticals, or materials science. However, handling and disposal should be approached with caution due to the potential toxicity and environmental impact of halogenated compounds.

Formula: C₆H₉F₂I

InChI: InChI=1S/C6H9F2I/c7-6(8)2-1-5(3-6)4-9/h5H,1-4H2

InChI key: InChIKey=OGPZYCIKOMJVFP-UHFFFAOYSA-N

SMILES: C(I)C1CC(F)(F)CC1

Synonyms:

• Cyclopentane, 1,1-difluoro-3-(iodomethyl)-
• 1,1-Difluoro-3-(iodomethyl)cyclopentane