CAS 104216-51-5

2-Methoxy-4,6-dimethylbenzeneacetic acid

Description:

2-Methoxy-4,6-dimethylbenzeneacetic acid, also known by its CAS number 104216-51-5, is an organic compound characterized by its aromatic structure, which includes a methoxy group and two methyl substituents on a benzene ring, along with an acetic acid functional group. This compound typically exhibits properties associated with both aromatic compounds and carboxylic acids, such as moderate solubility in organic solvents and potential acidity due to the carboxylic acid group. The presence of the methoxy and methyl groups can influence its reactivity and polarity, potentially enhancing its lipophilicity. It may participate in various chemical reactions, including esterification and nucleophilic substitutions, and could serve as an intermediate in organic synthesis or as a building block in pharmaceuticals. Additionally, its structural features may confer specific biological activities, making it of interest in medicinal chemistry. However, detailed studies on its toxicity, environmental impact, and specific applications would be necessary for a comprehensive understanding of this compound.

Formula: C₁₁H₁₄O₃

InChI: InChI=1S/C11H14O3/c1-7-4-8(2)9(6-11(12)13)10(5-7)14-3/h4-5H,6H2,1-3H3,(H,12,13)

InChI key: InChIKey=BVMOGYNWYADPHX-UHFFFAOYSA-N

SMILES: C(C(O)=O)C1=C(OC)C=C(C)C=C1C

Synonyms:

• 2-Methoxy-4,6-dimethylbenzeneacetic acid
• 2-(2-Methoxy-4,6-dimethylphenyl)acetic acid
• Benzeneacetic acid, 2-methoxy-4,6-dimethyl-
• Acetic acid, (6-methoxy-2,4-xylyl)-