CAS 104222-42-6

3-Bromo-2,4,5-trifluorobenzoic acid

Description:

3-Bromo-2,4,5-trifluorobenzoic acid is an aromatic carboxylic acid characterized by the presence of a bromine atom and three fluorine atoms attached to a benzoic acid structure. The molecular formula for this compound is C7H2BrF3O2, indicating a relatively complex halogenated structure. It typically appears as a solid at room temperature and is known for its high reactivity due to the presence of electronegative halogens, which can influence its chemical behavior and interactions. The trifluoromethyl groups contribute to its lipophilicity and potential applications in pharmaceuticals and agrochemicals. This compound may exhibit acidic properties, allowing it to participate in various chemical reactions, including esterification and nucleophilic substitution. Additionally, its unique halogen substituents can enhance its biological activity, making it a subject of interest in medicinal chemistry. Safety precautions should be taken when handling this compound, as halogenated compounds can pose health risks and environmental concerns.

Formula: C₇H₂BrF₃O₂

InChI: InChI=1/C7H2BrF3O2/c8-4-5(10)2(7(12)13)1-3(9)6(4)11/h1H,(H,12,13)

SMILES: c1c(c(c(c(c1F)F)Br)F)C(=O)O

Synonyms:

• 2,4,5-Trifluoro-3-Bromobenzoic Acid
• 3-Bromo-2,4,5,6-Tetrafluorobenzoic Acid
• 3-BROMO-2,4,5-TRIFLUOROBENZOIC ACID

3-Bromo-2,4,5-trifluorobenzoic acid

CAS: 104222-42-6

Formula: C₇H₂BrF₃O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 254.9888

Ref: IN-DA003IZV

3-Bromo-2,4,5-trifluorobenzoic acid

CAS: 104222-42-6

3-Bromo-2,4,5-trifluorobenzoic acid

Formula: C₇H₂BrF₃O₂

Purity: ≥95%

Color and Shape: light yellow/orange crystalline solid

Molecular weight: 254.99g/mol

Ref: 54-PC10514

3-Bromo-2,4,5-trifluorobenzoic acid

CAS: 104222-42-6

Formula: C₇H₂BrF₃O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 254.99

Ref: 10-F337889