CAS 104224-63-7: 2-(1-Adamantyl)-4-bromoanisole
Description:2-(1-Adamantyl)-4-bromoanisole, with the CAS number 104224-63-7, is an organic compound characterized by its unique structure that includes an adamantyl group, a bromine atom, and a methoxy group attached to a benzene ring. This compound typically exhibits a white to off-white crystalline appearance. It is known for its moderate solubility in organic solvents such as ethanol and dichloromethane, while being less soluble in water due to its hydrophobic adamantyl moiety. The presence of the bromine atom introduces a degree of reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. Additionally, the adamantyl group contributes to its steric bulk, which can influence its reactivity and interactions with biological systems. This compound may be of interest in medicinal chemistry and materials science, particularly in the development of pharmaceuticals or as a building block in organic synthesis. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C17H21BrO
InChI:InChI=1S/C17H21BrO/c1-19-16-3-2-14(18)7-15(16)17-8-11-4-12(9-17)6-13(5-11)10-17/h2-3,7,11-13H,4-6,8-10H2,1H3
InChI key:InChIKey=QQAMHHZQONQBFZ-UHFFFAOYSA-N
SMILES:BrC1=CC=C(OC)C(=C1)C23CC4CC(CC(C4)C2)C3
- Synonyms:
- 1-(5-Bromo-2-Methosyphenyl)-Tricyclo[3.3.1.13.7]Decane
- 1-(5-Bromo-2-Methoxyphenyl)-Tricyclo[3,3,1,13,7]Decane
- 1-(5-Bromo-2-Methoxyphenyl)-Tricyclo[3.3.1.13,7]Decane
- 1-(5-Bromo-2-Methoxyphenyl)-Trycyclo[3.3.1.13,7]Decane
- 1-(5-Bromo-2-Methoxyphenyl)Tricyclo[3.3.1.1~3,7~]Decane
- 1-(5-Bromo-2-Methoxyphenyl)Trycyclo[3,3,1,13,7]Decane
- 1-(5-Bromo-2-methoxy-phenyl)adamantane
- 1-(5-Bromo-2-methoxyphenyl)adamantane
- 1-(5-Bromo-2-methoxyphenyl)tricyclo[3.3.1.1<sup>3,7</sup>]decane
- 1-Methoxy-2-(1-adamantyl)-4-bromobenzene
- See more synonyms
- 2-(1-Adamantyl)-4-Bromo Anisole
- 2-(1-Adamantyl)-4-bromomethoxybenzene
- 2-(Adamantan-1-yl)-4-bromoanisole, 2-(Adamantan-1-yl)-4-bromo-1-methoxybenzene
- 2-Adamantyl-4-bromoanisole
- 4-Bromo-2-(1-adamantyl)anisole
- Adapalene-2-(1-Adamantyl)-4-bromo-anisole
- Tricyclo[3.3.1.13,7]Decane, 1-(5-Bromo-2-Methoxyphenyl)-
- Tricyclo[3.3.1.1<sup>3,7</sup>]decane, 1-(5-bromo-2-methoxyphenyl)-
- 2-(1-Adamantyl)-4-bromoanisole