CAS 104224-68-2
:2-(1-Adamantyl)-4-bromophenol
Description:
2-(1-Adamantyl)-4-bromophenol, with the CAS number 104224-68-2, is an organic compound characterized by its unique structure that combines an adamantyl group with a bromophenol moiety. This compound typically exhibits a solid state at room temperature and is known for its potential applications in medicinal chemistry and material science due to its interesting biological and chemical properties. The presence of the bromine atom enhances its reactivity and can influence its solubility in various solvents. The adamantyl group contributes to the compound's hydrophobic characteristics, which may affect its interaction with biological membranes. Additionally, the phenolic hydroxyl group can participate in hydrogen bonding, influencing its behavior in different chemical environments. Overall, 2-(1-Adamantyl)-4-bromophenol is a compound of interest for further research, particularly in the fields of drug development and synthetic chemistry, where its unique structural features may lead to novel applications.
Formula:C16H19BrO
InChI:InChI=1/C16H19BrO/c17-13-1-2-15(18)14(6-13)16-7-10-3-11(8-16)5-12(4-10)9-16/h1-2,6,10-12,18H,3-5,7-9H2/t10-,11-,12-,16-
SMILES:c1cc(c(cc1Br)C12C[C@H]3C[C@@H](C[C@H](C3)C2)C1)O
Synonyms:- 4-Bromo-2-Adamantyl Phenol
- (2-Adamantyl)-4-Bromophenol
- 2-(Adamantan-1-yl)-4-bromophenol
- 2-Adamantane-4-Bromoanisole
- 2-(Adamantan-1-yl)-4-bromophenol 98%
- 2-(1-Adamantyl)-4-bromophenol (Adapalene)
- 4-Bromo-2-Tricyclo[3.3.1.1~3,7~]Dec-1-Ylphenol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
2-Adamantyl-4-bromophenol
CAS:Formula:C16H19BrOPurity:98%Color and Shape:SolidMolecular weight:307.22552-(Adamantan-1-yl)-4-bromophenol
CAS:2-(Adamantan-1-yl)-4-bromophenolPurity:98%Molecular weight:307.23g/mol2-(1-Adamantyl)-4-bromophenol
CAS:2-(1-Adamantyl)-4-bromophenol is a synthetic polymer that is used in the production of film. It has been used to produce chromatographic films, which are used for the separation and purification of organic compounds. 2-(1-Adamantyl)-4-bromophenol is also used to manufacture ion-exchange resins, which are used for the separation and purification of ions in water. 2-(1-Adamantyl)-4-bromophenol has been shown to be carcinogenic when administered orally to rats, causing human colon carcinoma. It also causes pleural mesothelioma when administered intrapleurally in rats. This chemical has been shown to have anti-inflammatory properties due to its ability to inhibit prostaglandin synthesis.Formula:C16H19BrOPurity:Min. 95%Color and Shape:PowderMolecular weight:307.23 g/mol


