CAS 104227-86-3
:6-Deoxypenciclovir
Description:
6-Deoxypenciclovir is an antiviral compound primarily studied for its potential in treating herpesvirus infections. It is a derivative of penciclovir, which is known for its activity against herpes simplex virus (HSV) and varicella-zoster virus (VZV). The chemical structure of 6-deoxypenciclovir features a modified side chain that enhances its pharmacological properties. This compound exhibits characteristics typical of nucleoside analogs, including the ability to inhibit viral DNA polymerase, thereby interfering with viral replication. Its mechanism of action involves selective incorporation into viral DNA, leading to chain termination. The compound is generally characterized by its stability and solubility in various solvents, which can influence its bioavailability and therapeutic efficacy. Research into 6-deoxypenciclovir continues to explore its potential advantages over existing antiviral therapies, including reduced resistance and improved safety profiles. As with many antiviral agents, the effectiveness and safety of 6-deoxypenciclovir are subject to ongoing clinical evaluation.
Formula:C10H15N5O2
InChI:InChI=1/C10H15N5O2/c11-10-12-3-8-9(14-10)15(6-13-8)2-1-7(4-16)5-17/h3,6-7,16-17H,1-2,4-5H2,(H2,11,12,14)
InChI key:InChIKey=WJOWACPJSFGNRM-UHFFFAOYSA-N
SMILES:C(CC(CO)CO)N1C=2C(N=C1)=CN=C(N)N2
Synonyms:- 1,3-Propanediol, 2-(2-(2-amino-9H-purin-9-yl)ethyl)-
- 2-Amino-9-(4-hydroxy-3-hydroxymethylbut-1-yl)purine
- 2-[2-(2-Aminopurin-9-yl)ethyl]propane-1,3-diol
- 2-[2-(2-amino-9H-purin-9-yl)ethyl]propane-1,3-diol
- 6-Deoxy Penciclovir
- 6-Deoxypenciclovir
- Brl 42359
- Di-Desacetyl Famciclovir
- DidesacetylFamciclovir,BRL42359
- 2-[2-(2-Amino-9H-purin-9-yl)ethyl]-1,3-propanediol
- Famciclovir USP RC A
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
1,3-Propanediol, 2-[2-(2-amino-9H-purin-9-yl)ethyl]-
CAS:Formula:C10H15N5O2Purity:98%Color and Shape:SolidMolecular weight:237.25846-Deoxypenciclovir
CAS:Controlled ProductApplications A metabolite of Famciclovir, an antiviral.
References Harnden, M.R., et al.: J. Med. Chem., 32, 1738 (1989)Formula:C10H15N5O2Color and Shape:Off White SolidMolecular weight:237.266-Deoxypenciclovir
CAS:6-Deoxypenciclovir is an oral prodrug of penciclovir that is hydrolyzed to penciclovir in vivo. This prodrug has high bioavailability and is absorbed in the bloodstream through the hepatic portal system. It is a competitive inhibitor of human DNA polymerase, which prevents viral replication by inhibiting dna synthesis. 6-Deoxypenciclovir competitively inhibits sodium salts, enzyme activities, molybdenum, human liver, humans, kinetic, drug interactions, acid formation, natural compounds, human metabolism, estrogen receptor modulators and human pharmacokinetic.
Formula:C10H15N5O2Purity:Min. 95%Color and Shape:White PowderMolecular weight:237.26 g/mol





