CAS 104227-89-6
:9-[2-(2,2-Dimethyl-1,3-dioxan-5-yl)ethyl]-9H-purin-2-amine
Description:
9-[2-(2,2-Dimethyl-1,3-dioxan-5-yl)ethyl]-9H-purin-2-amine, with the CAS number 104227-89-6, is a purine derivative characterized by its unique structural features. This compound contains a purine base, which is a fundamental component of nucleic acids, and is substituted with a 2-(2,2-dimethyl-1,3-dioxan-5-yl)ethyl group. The presence of the dioxane moiety contributes to its solubility and stability, while the dimethyl groups may influence its steric properties and biological activity. Typically, such compounds are of interest in medicinal chemistry due to their potential roles as nucleoside analogs or in modulating biological pathways. The specific arrangement of functional groups can affect the compound's interactions with enzymes or receptors, making it a candidate for further research in pharmacology or biochemistry. Its synthesis and characterization would involve standard organic chemistry techniques, and its properties would be assessed through various analytical methods to determine purity, stability, and biological efficacy.
Formula:C13H19N5O2
InChI:InChI=1S/C13H19N5O2/c1-13(2)19-6-9(7-20-13)3-4-18-8-16-10-5-15-12(14)17-11(10)18/h5,8-9H,3-4,6-7H2,1-2H3,(H2,14,15,17)
InChI key:InChIKey=JAGXUSFVFJWYHH-UHFFFAOYSA-N
SMILES:C(CC1COC(C)(C)OC1)N2C=3C(N=C2)=CN=C(N)N3
Synonyms:- 9H-Purin-2-amine, 9-[2-(2,2-dimethyl-1,3-dioxan-5-yl)ethyl]-
- 9-[2-(2,2-Dimethyl-1,3-dioxan-5-yl)ethyl]-9H-purin-2-amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.