CAS 104245-09-2
:anguibactin
Description:
Anguibactin is a siderophore, a type of molecule produced by certain bacteria to scavenge iron from the environment, which is crucial for their growth and metabolism. It is characterized by its ability to form stable complexes with ferric ions (Fe³⁺), thereby facilitating iron uptake in iron-limited conditions. Anguibactin is produced by specific strains of bacteria, such as those in the genus *Vibrio*, and is notable for its unique structure, which typically includes a cyclic peptide backbone and functional groups that enhance its iron-binding capacity. The presence of anguibactin can be significant in microbial ecology, influencing interactions between bacteria and their environments, as well as in biotechnological applications, such as bioremediation and agriculture. Its CAS number, 104245-09-2, allows for precise identification in chemical databases, aiding researchers in studying its properties and potential applications. Overall, anguibactin exemplifies the intricate biochemical strategies employed by microorganisms to thrive in competitive and nutrient-scarce environments.
Formula:C15H16N4O4S
InChI:InChI=1/C15H16N4O4S/c20-12-3-1-2-10(13(12)21)14-18-11(7-24-14)15(22)19(23)5-4-9-6-16-8-17-9/h1-3,6,8,11,18,20,23H,4-5,7H2,(H,16,17)/b14-10-
Synonyms:- Anguibactin
- (2Z)-N-hydroxy-2-(5-hydroxy-6-oxocyclohexa-2,4-dien-1-ylidene)-N-[2-(1H-imidazol-5-yl)ethyl]-1,3-thiazolidine-4-carboxamide
- 4-Thiazolecarboxamide, 2-(2,3-dihydroxyphenyl)-4,5-dihydro-N-hydroxy-N-[2-(1H-imidazol-4-yl)ethyl]-, (4R)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Anguibactin
CAS:<p>Anguibactin is an antibiotic that functions as an iron carrier, exhibiting strong affinity for Fe³⁺.</p>Formula:C15H16N4O4SColor and Shape:SolidMolecular weight:348.377
